C16H17F3N2O2S — CID 164678673
2'-(trifluoromethyl)spiro[1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine-3,1'-cyclohexane] 5,5-dioxide (PubChem CID 164678673) has the molecular formula C16H17F3N2O2S and a molecular weight of 358.39 g/mol. Its IUPAC name is 2'-(trifluoromethyl)spiro[1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine-3,1'-cyclohexane] 5,5-dioxide.
| Compound Name | 2'-(trifluoromethyl)spiro[1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine-3,1'-cyclohexane] 5,5-dioxide |
|---|---|
| PubChem CID | 164678673 |
| Molecular Formula | C16H17F3N2O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2'-(trifluoromethyl)spiro[1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine-3,1'-cyclohexane] 5,5-dioxide |
| SMILES | O=S1(=O)N=C2N(CCC23CCCCC3C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H17F3N2O2S/c17-16(18,19)13-7-3-4-8-15(13)9-10-21-11-5-1-2-6-12(11)24(22,23)20-14(15)21/h1-2,5-6,13H,3-4,7-10H2 |
| InChIKey | PJLGDCYXXPSFJV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |