C13H13F3N2O2S — CID 164678389
3-methyl-3-(2,2,2-trifluoroethyl)-1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide (PubChem CID 164678389) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-methyl-3-(2,2,2-trifluoroethyl)-1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide.
| Compound Name | 3-methyl-3-(2,2,2-trifluoroethyl)-1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
|---|---|
| PubChem CID | 164678389 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-methyl-3-(2,2,2-trifluoroethyl)-1,2-dihydropyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
| SMILES | CC1(CC(F)(F)F)CCN2C1=NS(=O)(=O)c1ccccc12 |
| InChI | InChI=1S/C13H13F3N2O2S/c1-12(8-13(14,15)16)6-7-18-9-4-2-3-5-10(9)21(19,20)17-11(12)18/h2-5H,6-8H2,1H3 |
| InChIKey | UGPAFZRESYMBJM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |