C12H11F3N2O2S — CID 164679582
3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide (PubChem CID 164679582) has the molecular formula C12H11F3N2O2S and a molecular weight of 304.29 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide.
| Compound Name | 3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
|---|---|
| PubChem CID | 164679582 |
| Molecular Formula | C12H11F3N2O2S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-(2,2,2-trifluoroethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
| SMILES | O=S1(=O)N=C2C(CC(F)(F)F)CCN2c2ccccc21 |
| InChI | InChI=1S/C12H11F3N2O2S/c13-12(14,15)7-8-5-6-17-9-3-1-2-4-10(9)20(18,19)16-11(8)17/h1-4,8H,5-7H2 |
| InChIKey | VBPWBUFSCJMZBH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |