C17H12BrF3N2O — CID 164679570
1-benzyl-6-bromo-3-(2,2,2-trifluoroethylimino)indol-2-one (PubChem CID 164679570) has the molecular formula C17H12BrF3N2O and a molecular weight of 397.19 g/mol. Its IUPAC name is 1-benzyl-6-bromo-3-(2,2,2-trifluoroethylimino)indol-2-one.
| Compound Name | 1-benzyl-6-bromo-3-(2,2,2-trifluoroethylimino)indol-2-one |
|---|---|
| PubChem CID | 164679570 |
| Molecular Formula | C17H12BrF3N2O |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-benzyl-6-bromo-3-(2,2,2-trifluoroethylimino)indol-2-one |
| SMILES | O=C1/C(=N/CC(F)(F)F)c2ccc(Br)cc2N1Cc1ccccc1 |
| InChI | InChI=1S/C17H12BrF3N2O/c18-12-6-7-13-14(8-12)23(9-11-4-2-1-3-5-11)16(24)15(13)22-10-17(19,20)21/h1-8H,9-10H2/b22-15+ |
| InChIKey | OOVYFCSHAPHZBG-PXLXIMEGSA-N |
| XLogP | 4.35 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|