C19H29NO3 — CID 164679586
[1-(4-methylphenyl)-1-oxopropan-2-yl] N,N-dibutylcarbamate (PubChem CID 164679586) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] N,N-dibutylcarbamate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] N,N-dibutylcarbamate |
|---|---|
| PubChem CID | 164679586 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] N,N-dibutylcarbamate |
| SMILES | CCCCN(CCCC)C(=O)OC(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H29NO3/c1-5-7-13-20(14-8-6-2)19(22)23-16(4)18(21)17-11-9-15(3)10-12-17/h9-12,16H,5-8,13-14H2,1-4H3 |
| InChIKey | PUAHVGKXNCOWEX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |