tert-butyl 5,5-dideuterio-2-iodopent-4-enoate

C9H15IO2 — CID 164680378

IUPACtert-butyl 5,5-dideuterio-2-iodopent-4-enoate
SMILES[2H]C([2H])=CCC(I)C(=O)OC(C)(C)C
InChIInChI=1S/C9H15IO2/c1-5-6-7(10)8(11)12-9(2,3)4/h5,7H,1,6H2,2-4H3/i1D2
InChIKeyRCUZHKHSGXHXEN-DICFDUPASA-N
MW284.13 g/mol
LogP2.71
Rot. Bonds3

About tert-butyl 5,5-dideuterio-2-iodopent-4-enoate

tert-butyl 5,5-dideuterio-2-iodopent-4-enoate (PubChem CID 164680378) has the molecular formula C9H15IO2 and a molecular weight of 284.13 g/mol. Its IUPAC name is tert-butyl 5,5-dideuterio-2-iodopent-4-enoate.

Molecular Properties

Compound Nametert-butyl 5,5-dideuterio-2-iodopent-4-enoate
PubChem CID164680378
Molecular FormulaC9H15IO2
Molecular Weight284.13 g/mol
Exact Mass284.02
IUPAC Nametert-butyl 5,5-dideuterio-2-iodopent-4-enoate
SMILES[2H]C([2H])=CCC(I)C(=O)OC(C)(C)C
InChIInChI=1S/C9H15IO2/c1-5-6-7(10)8(11)12-9(2,3)4/h5,7H,1,6H2,2-4H3/i1D2
InChIKeyRCUZHKHSGXHXEN-DICFDUPASA-N
XLogP2.71
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.13
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze tert-butyl 5,5-dideuterio-2-iodopent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 5,5-dideuterio-2-iodopent-4-enoate?
The IUPAC name of tert-butyl 5,5-dideuterio-2-iodopent-4-enoate (CID 164680378) is tert-butyl 5,5-dideuterio-2-iodopent-4-enoate.
What is the SMILES notation for tert-butyl 5,5-dideuterio-2-iodopent-4-enoate?
The canonical SMILES for tert-butyl 5,5-dideuterio-2-iodopent-4-enoate is [2H]C([2H])=CCC(I)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 5,5-dideuterio-2-iodopent-4-enoate?
The InChIKey is RCUZHKHSGXHXEN-DICFDUPASA-N. The full InChI is InChI=1S/C9H15IO2/c1-5-6-7(10)8(11)12-9(2,3)4/h5,7H,1,6H2,2-4H3/i1D2.
What are the key properties of tert-butyl 5,5-dideuterio-2-iodopent-4-enoate?
tert-butyl 5,5-dideuterio-2-iodopent-4-enoate has a molecular weight of 284.13 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5,5-dideuterio-2-iodopent-4-enoate is sourced from PubChem (CID 164680378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).