C9H15IO2 — CID 164680378
tert-butyl 5,5-dideuterio-2-iodopent-4-enoate (PubChem CID 164680378) has the molecular formula C9H15IO2 and a molecular weight of 284.13 g/mol. Its IUPAC name is tert-butyl 5,5-dideuterio-2-iodopent-4-enoate.
| Compound Name | tert-butyl 5,5-dideuterio-2-iodopent-4-enoate |
|---|---|
| PubChem CID | 164680378 |
| Molecular Formula | C9H15IO2 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | tert-butyl 5,5-dideuterio-2-iodopent-4-enoate |
| SMILES | [2H]C([2H])=CCC(I)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H15IO2/c1-5-6-7(10)8(11)12-9(2,3)4/h5,7H,1,6H2,2-4H3/i1D2 |
| InChIKey | RCUZHKHSGXHXEN-DICFDUPASA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|