C33H32N2O2 — CID 164680799
methyl (5R,6S,7S)-2-ethyl-1-methyl-5-(3-methyl-1H-indol-2-yl)-6,7-diphenyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate (PubChem CID 164680799) has the molecular formula C33H32N2O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is methyl (5R,6S,7S)-2-ethyl-1-methyl-5-(3-methyl-1H-indol-2-yl)-6,7-diphenyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate.
| Compound Name | methyl (5R,6S,7S)-2-ethyl-1-methyl-5-(3-methyl-1H-indol-2-yl)-6,7-diphenyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 164680799 |
| Molecular Formula | C33H32N2O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | methyl (5R,6S,7S)-2-ethyl-1-methyl-5-(3-methyl-1H-indol-2-yl)-6,7-diphenyl-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
| SMILES | CCc1c(C)c2n(c1C(=O)OC)[C@@H](c1[nH]c3ccccc3c1C)[C@H](c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C33H32N2O2/c1-5-24-21(3)30-27(22-14-8-6-9-15-22)28(23-16-10-7-11-17-23)32(35(30)31(24)33(36)37-4)29-20(2)25-18-12-13-19-26(25)34-29/h6-19,27-28,32,34H,5H2,1-4H3/t27-,28-,32-/m1/s1 |
| InChIKey | APIGPVQCDSNZFH-DMBDEWFESA-N |
| XLogP | 7.45 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|