C26H29N3O5 — CID 164682427
2-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]but-3-en-1-ol (PubChem CID 164682427) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]but-3-en-1-ol.
| Compound Name | 2-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 164682427 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]but-3-en-1-ol |
| SMILES | C=CC(C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1)CO |
| InChI | InChI=1S/C26H29N3O5/c1-4-19(17-30)8-9-20-6-5-7-21(14-20)29-26-22-15-24(33-12-10-31-2)25(34-13-11-32-3)16-23(22)27-18-28-26/h4-7,14-16,18-19,30H,1,10-13,17H2,2-3H3,(H,27,28,29) |
| InChIKey | GHRDKFMSAKIASF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|