C16H14OS2 — CID 164682428
(2E,5E)-6,8-dithiophen-2-ylocta-2,5-dien-7-yn-1-ol (PubChem CID 164682428) has the molecular formula C16H14OS2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2E,5E)-6,8-dithiophen-2-ylocta-2,5-dien-7-yn-1-ol.
| Compound Name | (2E,5E)-6,8-dithiophen-2-ylocta-2,5-dien-7-yn-1-ol |
|---|---|
| PubChem CID | 164682428 |
| Molecular Formula | C16H14OS2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2E,5E)-6,8-dithiophen-2-ylocta-2,5-dien-7-yn-1-ol |
| SMILES | OC/C=C/C/C=C(\C#Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H14OS2/c17-11-3-1-2-6-14(16-8-5-13-19-16)9-10-15-7-4-12-18-15/h1,3-8,12-13,17H,2,11H2/b3-1+,14-6+ |
| InChIKey | PDYDQLZASOJVOX-AXMUMVEWSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|