C17H18O6 — CID 164684078
methyl (3S,3aR,4S,6aS)-2,6-dioxo-4-phenyl-3-propan-2-yl-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate (PubChem CID 164684078) has the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. Its IUPAC name is methyl (3S,3aR,4S,6aS)-2,6-dioxo-4-phenyl-3-propan-2-yl-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate.
| Compound Name | methyl (3S,3aR,4S,6aS)-2,6-dioxo-4-phenyl-3-propan-2-yl-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate |
|---|---|
| PubChem CID | 164684078 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | methyl (3S,3aR,4S,6aS)-2,6-dioxo-4-phenyl-3-propan-2-yl-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate |
| SMILES | COC(=O)[C@@]12OC(=O)[C@@H](C(C)C)[C@@H]1[C@@H](c1ccccc1)OC2=O |
| InChI | InChI=1S/C17H18O6/c1-9(2)11-12-13(10-7-5-4-6-8-10)22-16(20)17(12,15(19)21-3)23-14(11)18/h4-9,11-13H,1-3H3/t11-,12+,13+,17-/m0/s1 |
| InChIKey | IGBVBNOKFWOATB-ZBYUQBLASA-N |
| XLogP | 1.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|