C25H20FNO3 — CID 164686602
(3S,3'S)-1-benzyl-3'-ethyl-3'-(2-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione (PubChem CID 164686602) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is (3S,3'S)-1-benzyl-3'-ethyl-3'-(2-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione.
| Compound Name | (3S,3'S)-1-benzyl-3'-ethyl-3'-(2-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
|---|---|
| PubChem CID | 164686602 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (3S,3'S)-1-benzyl-3'-ethyl-3'-(2-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
| SMILES | CC[C@@]1(c2ccccc2F)C(=O)O[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C25H20FNO3/c1-2-24(18-12-6-8-14-20(18)26)23(29)30-25(24)19-13-7-9-15-21(19)27(22(25)28)16-17-10-4-3-5-11-17/h3-15H,2,16H2,1H3/t24-,25-/m1/s1 |
| InChIKey | WGYHVRRXFZUYLJ-JWQCQUIFSA-N |
| XLogP | 4.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|