C23H35NO4Si — CID 164687414
[(1S)-1-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 164687414) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is [(1S)-1-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [(1S)-1-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 164687414 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(1S)-1-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-ynyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)O[C@H](C#Cc1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H35NO4Si/c1-17(24-21(26)28-22(2,3)4)20(25)27-19(29(8,9)23(5,6)7)16-15-18-13-11-10-12-14-18/h10-14,17,19H,1-9H3,(H,24,26)/t17?,19-/m0/s1 |
| InChIKey | JQGCMQLTGKQUAQ-NNBQYGFHSA-N |
| XLogP | 4.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|