C22H25N — CID 164706111
CID 164706111 (PubChem CID 164706111) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol.
| Compound Name | CID 164706111 |
|---|---|
| PubChem CID | 164706111 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccccc2)cc1N1[C]C2(C)CCC1(C)CC2 |
| InChI | InChI=1S/C22H25N/c1-17-9-10-19(18-7-5-4-6-8-18)15-20(17)23-16-21(2)11-13-22(23,3)14-12-21/h4-10,15H,11-14H2,1-3H3 |
| InChIKey | UHLHEYRUDFOTHD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |