C22H20FN5OS — CID 164719236
3-ethyl-16-fluoro-10-methyl-20-oxa-9-thia-3,4,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8(12),10,13(18),14,16,21,23-decaen-22-amine (PubChem CID 164719236) has the molecular formula C22H20FN5OS and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-ethyl-16-fluoro-10-methyl-20-oxa-9-thia-3,4,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8(12),10,13(18),14,16,21,23-decaen-22-amine.
| Compound Name | 3-ethyl-16-fluoro-10-methyl-20-oxa-9-thia-3,4,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8(12),10,13(18),14,16,21,23-decaen-22-amine |
|---|---|
| PubChem CID | 164719236 |
| Molecular Formula | C22H20FN5OS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-ethyl-16-fluoro-10-methyl-20-oxa-9-thia-3,4,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),4,8(12),10,13(18),14,16,21,23-decaen-22-amine |
| SMILES | CCn1ncc2c1-c1cnc(N)c(c1)OCc1cc(F)ccc1-c1nc(C)sc1C2 |
| InChI | InChI=1S/C22H20FN5OS/c1-3-28-21-13-7-18(22(24)25-9-13)29-11-15-6-16(23)4-5-17(15)20-19(30-12(2)27-20)8-14(21)10-26-28/h4-7,9-10H,3,8,11H2,1-2H3,(H2,24,25) |
| InChIKey | LQWDPDOTDSAWBJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|