C24H22NO+ — CID 164723194
3,10,14,18,20-pentamethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 164723194) has the molecular formula C24H22NO+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 3,10,14,18,20-pentamethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 3,10,14,18,20-pentamethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 164723194 |
| Molecular Formula | C24H22NO+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3,10,14,18,20-pentamethyl-12-oxa-20-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1ccc2c(C)c[n+](C)c3c2c1Oc1c-3c(C)c2ccccc2c1C |
| InChI | InChI=1S/C24H22NO/c1-13-10-11-17-14(2)12-25(5)22-20-15(3)18-8-6-7-9-19(18)16(4)24(20)26-23(13)21(17)22/h6-12H,1-5H3/q+1 |
| InChIKey | ZHXBGKKPAXBBFU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|