C43H35BO3 — CID 164724664
4,4,5,5-tetramethyl-2-[6-[4-[1,2,3,4-tetradeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]phenyl]dibenzofuran-4-yl]-1,3,2-dioxaborolane (PubChem CID 164724664) has the molecular formula C43H35BO3 and a molecular weight of 619.62 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[6-[4-[1,2,3,4-tetradeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]phenyl]dibenzofuran-4-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[6-[4-[1,2,3,4-tetradeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]phenyl]dibenzofuran-4-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164724664 |
| Molecular Formula | C43H35BO3 |
| Molecular Weight | 619.62 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[6-[4-[1,2,3,4-tetradeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)fluoren-9-yl]phenyl]dibenzofuran-4-yl]-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3ccc(-c4cccc5c4oc4c(B6OC(C)(C)C(C)(C)O6)cccc45)cc3)c3ccccc3-c3c([2H])c([2H])c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C43H35BO3/c1-41(2)42(3,4)47-44(46-41)38-23-13-20-35-34-19-12-18-31(39(34)45-40(35)38)28-24-26-30(27-25-28)43(29-14-6-5-7-15-29)36-21-10-8-16-32(36)33-17-9-11-22-37(33)43/h5-27H,1-4H3/i5D,6D,7D,8D,10D,14D,15D,16D,21D |
| InChIKey | PKMUALIBIPEXMW-BNNNJUMBSA-N |
| XLogP | 9.92 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.62 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|