C37H23ClO — CID 164769007
4-[4-(7-chloro-1,2,3,4-tetradeuterio-9-phenylfluoren-9-yl)phenyl]dibenzofuran (PubChem CID 164769007) has the molecular formula C37H23ClO and a molecular weight of 523.07 g/mol. Its IUPAC name is 4-[4-(7-chloro-1,2,3,4-tetradeuterio-9-phenylfluoren-9-yl)phenyl]dibenzofuran.
| Compound Name | 4-[4-(7-chloro-1,2,3,4-tetradeuterio-9-phenylfluoren-9-yl)phenyl]dibenzofuran |
|---|---|
| PubChem CID | 164769007 |
| Molecular Formula | C37H23ClO |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 4-[4-(7-chloro-1,2,3,4-tetradeuterio-9-phenylfluoren-9-yl)phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1ccc(Cl)cc1C2(c1ccccc1)c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C37H23ClO/c38-27-21-22-30-29-11-4-6-15-33(29)37(34(30)23-27,25-9-2-1-3-10-25)26-19-17-24(18-20-26)28-13-8-14-32-31-12-5-7-16-35(31)39-36(28)32/h1-23H/i4D,6D,11D,15D |
| InChIKey | WPNGNZIROKWXOY-FFDZZTBRSA-N |
| XLogP | 10.27 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |