C13H11N5O2 — CID 164728567
methyl 3-[6-(3-cyanophenyl)-1,2,4,5-tetrazin-3-yl]propanoate (PubChem CID 164728567) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 3-[6-(3-cyanophenyl)-1,2,4,5-tetrazin-3-yl]propanoate.
| Compound Name | methyl 3-[6-(3-cyanophenyl)-1,2,4,5-tetrazin-3-yl]propanoate |
|---|---|
| PubChem CID | 164728567 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | methyl 3-[6-(3-cyanophenyl)-1,2,4,5-tetrazin-3-yl]propanoate |
| SMILES | COC(=O)CCc1nnc(-c2cccc(C#N)c2)nn1 |
| InChI | InChI=1S/C13H11N5O2/c1-20-12(19)6-5-11-15-17-13(18-16-11)10-4-2-3-9(7-10)8-14/h2-4,7H,5-6H2,1H3 |
| InChIKey | IAWLQGAHTVDLAR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 101.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |