C19H20ClN3O5 — CID 59491889
4-(3-chloropropanoyloxy)butyl 3-[3-(3-cyanophenyl)-1,2,4-oxadiazol-5-yl]propanoate (PubChem CID 59491889) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is 4-(3-chloropropanoyloxy)butyl 3-[3-(3-cyanophenyl)-1,2,4-oxadiazol-5-yl]propanoate.
| Compound Name | 4-(3-chloropropanoyloxy)butyl 3-[3-(3-cyanophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
|---|---|
| PubChem CID | 59491889 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-(3-chloropropanoyloxy)butyl 3-[3-(3-cyanophenyl)-1,2,4-oxadiazol-5-yl]propanoate |
| SMILES | N#Cc1cccc(-c2noc(CCC(=O)OCCCCOC(=O)CCCl)n2)c1 |
| InChI | InChI=1S/C19H20ClN3O5/c20-9-8-18(25)27-11-2-1-10-26-17(24)7-6-16-22-19(23-28-16)15-5-3-4-14(12-15)13-21/h3-5,12H,1-2,6-11H2 |
| InChIKey | ZDLSLNPVAJKSKW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|