C20H20ClF2N3O3 — CID 164730683
(1S,2R,3R,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3-methylcyclopentane-1,2-diol (PubChem CID 164730683) has the molecular formula C20H20ClF2N3O3 and a molecular weight of 423.85 g/mol. Its IUPAC name is (1S,2R,3R,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3-methylcyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 164730683 |
| Molecular Formula | C20H20ClF2N3O3 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (1S,2R,3R,5R)-5-(4-amino-7-fluoropyrrolo[3,2-c]pyridin-1-yl)-3-[(4-chloro-3-fluorophenyl)-hydroxymethyl]-3-methylcyclopentane-1,2-diol |
| SMILES | C[C@]1(C(O)c2ccc(Cl)c(F)c2)C[C@@H](n2ccc3c(N)ncc(F)c32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20ClF2N3O3/c1-20(17(28)9-2-3-11(21)12(22)6-9)7-14(16(27)18(20)29)26-5-4-10-15(26)13(23)8-25-19(10)24/h2-6,8,14,16-18,27-29H,7H2,1H3,(H2,24,25)/t14-,16+,17?,18+,20-/m1/s1 |
| InChIKey | GOOIEQNNWPPNOR-BAWZPUNJSA-N |
| XLogP | 2.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |