About 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol
3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol (PubChem CID 164732401) has the molecular formula C9H8F4O
and a molecular weight of 208.15 g/mol. Its IUPAC name is 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol.
Molecular Properties
| Compound Name | 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol |
| PubChem CID | 164732401 |
| Molecular Formula | C9H8F4O |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol |
| SMILES | Cc1c(O)ccc(CC(F)(F)F)c1F |
| InChI | InChI=1S/C9H8F4O/c1-5-7(14)3-2-6(8(5)10)4-9(11,12)13/h2-3,14H,4H2,1H3 |
| InChIKey | BFZHTVPNJWSLRS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol?
The IUPAC name of 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol (CID 164732401) is 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol.
What is the SMILES notation for 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol?
The canonical SMILES for 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol is Cc1c(O)ccc(CC(F)(F)F)c1F.
What is the InChIKey of 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol?
The InChIKey is BFZHTVPNJWSLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F4O/c1-5-7(14)3-2-6(8(5)10)4-9(11,12)13/h2-3,14H,4H2,1H3.
What are the key properties of 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol?
3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol has a molecular weight of 208.15 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-methyl-4-(2,2,2-trifluoroethyl)phenol is sourced from PubChem (CID 164732401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).