About (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate
(3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate (PubChem CID 164737970) has the molecular formula C12H21ClO2
and a molecular weight of 232.75 g/mol. Its IUPAC name is (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate.
Molecular Properties
| Compound Name | (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate |
| PubChem CID | 164737970 |
| Molecular Formula | C12H21ClO2 |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate |
| SMILES | CC(C)(Cl)C(=O)OC1CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H21ClO2/c1-11(2,3)8-6-9(7-8)15-10(14)12(4,5)13/h8-9H,6-7H2,1-5H3 |
| InChIKey | PSVBYAGINGHJFW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate?
The IUPAC name of (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate (CID 164737970) is (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate.
What is the SMILES notation for (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate?
The canonical SMILES for (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate is CC(C)(Cl)C(=O)OC1CC(C(C)(C)C)C1.
What is the InChIKey of (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate?
The InChIKey is PSVBYAGINGHJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClO2/c1-11(2,3)8-6-9(7-8)15-10(14)12(4,5)13/h8-9H,6-7H2,1-5H3.
What are the key properties of (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate?
(3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate has a molecular weight of 232.75 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butylcyclobutyl) 2-chloro-2-methylpropanoate is sourced from PubChem (CID 164737970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).