C18H27Br3O6 — CID 58637398
[3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate (PubChem CID 58637398) has the molecular formula C18H27Br3O6 and a molecular weight of 579.12 g/mol. Its IUPAC name is [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate.
| Compound Name | [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 58637398 |
| Molecular Formula | C18H27Br3O6 |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 575.94 |
| IUPAC Name | [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OC1CC(OC(=O)C(C)(C)Br)CC(OC(=O)C(C)(C)Br)C1 |
| InChI | InChI=1S/C18H27Br3O6/c1-16(2,19)13(22)25-10-7-11(26-14(23)17(3,4)20)9-12(8-10)27-15(24)18(5,6)21/h10-12H,7-9H2,1-6H3 |
| InChIKey | IIDNORSHYIXUGA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|