About [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate
[3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate (PubChem CID 58637398) has the molecular formula C18H27Br3O6
and a molecular weight of 579.12 g/mol. Its IUPAC name is [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate.
Molecular Properties
| Compound Name | [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate |
| PubChem CID | 58637398 |
| Molecular Formula | C18H27Br3O6 |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 575.94 |
| IUPAC Name | [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OC1CC(OC(=O)C(C)(C)Br)CC(OC(=O)C(C)(C)Br)C1 |
| InChI | InChI=1S/C18H27Br3O6/c1-16(2,19)13(22)25-10-7-11(26-14(23)17(3,4)20)9-12(8-10)27-15(24)18(5,6)21/h10-12H,7-9H2,1-6H3 |
| InChIKey | IIDNORSHYIXUGA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate?
The IUPAC name of [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate (CID 58637398) is [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate.
What is the SMILES notation for [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate?
The canonical SMILES for [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate is CC(C)(Br)C(=O)OC1CC(OC(=O)C(C)(C)Br)CC(OC(=O)C(C)(C)Br)C1.
What is the InChIKey of [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate?
The InChIKey is IIDNORSHYIXUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27Br3O6/c1-16(2,19)13(22)25-10-7-11(26-14(23)17(3,4)20)9-12(8-10)27-15(24)18(5,6)21/h10-12H,7-9H2,1-6H3.
What are the key properties of [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate?
[3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate has a molecular weight of 579.12 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexyl] 2-bromo-2-methylpropanoate is sourced from PubChem (CID 58637398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).