C15H22Br2O6 — CID 155786566
3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexane-1-carboxylic acid (PubChem CID 155786566) has the molecular formula C15H22Br2O6 and a molecular weight of 458.14 g/mol. Its IUPAC name is 3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155786566 |
| Molecular Formula | C15H22Br2O6 |
| Molecular Weight | 458.14 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 3,5-bis[(2-bromo-2-methylpropanoyl)oxy]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(Br)C(=O)OC1CC(OC(=O)C(C)(C)Br)CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H22Br2O6/c1-14(2,16)12(20)22-9-5-8(11(18)19)6-10(7-9)23-13(21)15(3,4)17/h8-10H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | PTFVZRVKMGZMGF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|