C22H28O3 — CID 164739121
(1-ethylcyclopentyl) 4-butan-2-yl-1-hydroxynaphthalene-2-carboxylate (PubChem CID 164739121) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 4-butan-2-yl-1-hydroxynaphthalene-2-carboxylate.
| Compound Name | (1-ethylcyclopentyl) 4-butan-2-yl-1-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 164739121 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1-ethylcyclopentyl) 4-butan-2-yl-1-hydroxynaphthalene-2-carboxylate |
| SMILES | CCC(C)c1cc(C(=O)OC2(CC)CCCC2)c(O)c2ccccc12 |
| InChI | InChI=1S/C22H28O3/c1-4-15(3)18-14-19(20(23)17-11-7-6-10-16(17)18)21(24)25-22(5-2)12-8-9-13-22/h6-7,10-11,14-15,23H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | NFJNSYACNLCZJR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |