C12H15NO2 — CID 164740635
5-tert-butyl-7-methoxy-2,1-benzoxazole (PubChem CID 164740635) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-tert-butyl-7-methoxy-2,1-benzoxazole.
| Compound Name | 5-tert-butyl-7-methoxy-2,1-benzoxazole |
|---|---|
| PubChem CID | 164740635 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-tert-butyl-7-methoxy-2,1-benzoxazole |
| SMILES | COc1cc(C(C)(C)C)cc2conc12 |
| InChI | InChI=1S/C12H15NO2/c1-12(2,3)9-5-8-7-15-13-11(8)10(6-9)14-4/h5-7H,1-4H3 |
| InChIKey | MWOHKVZFRWVBKT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |