C24H37N3O7 — CID 164741002
2-butoxy-4-[[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoyl]amino]benzoic acid (PubChem CID 164741002) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-butoxy-4-[[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoyl]amino]benzoic acid.
| Compound Name | 2-butoxy-4-[[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 164741002 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-butoxy-4-[[(2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoyl]amino]benzoic acid |
| SMILES | CCCCOc1cc(NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C24H37N3O7/c1-8-9-12-33-18-13-16(10-11-17(18)22(30)31)26-20(28)15(4)25-21(29)19(14(2)3)27-23(32)34-24(5,6)7/h10-11,13-15,19H,8-9,12H2,1-7H3,(H,25,29)(H,26,28)(H,27,32)(H,30,31)/t15-,19-/m0/s1 |
| InChIKey | OJJUQABHCONUFV-KXBFYZLASA-N |
| XLogP | 3.56 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|