C31H9F2N7 — CID 164741239
(3E)-3-[cyano(isocyano)methylidene]-5-(diisocyanomethylidene)-2,6-difluoro-7-isocyano-4-phenyl-8-pyridin-2-yl-s-indacene-1-carbonitrile (PubChem CID 164741239) has the molecular formula C31H9F2N7 and a molecular weight of 517.46 g/mol. Its IUPAC name is (3E)-3-[cyano(isocyano)methylidene]-5-(diisocyanomethylidene)-2,6-difluoro-7-isocyano-4-phenyl-8-pyridin-2-yl-s-indacene-1-carbonitrile.
| Compound Name | (3E)-3-[cyano(isocyano)methylidene]-5-(diisocyanomethylidene)-2,6-difluoro-7-isocyano-4-phenyl-8-pyridin-2-yl-s-indacene-1-carbonitrile |
|---|---|
| PubChem CID | 164741239 |
| Molecular Formula | C31H9F2N7 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | (3E)-3-[cyano(isocyano)methylidene]-5-(diisocyanomethylidene)-2,6-difluoro-7-isocyano-4-phenyl-8-pyridin-2-yl-s-indacene-1-carbonitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1C(F)=C([N+]#[C-])c2c1c(-c1ccccc1)c1c(c2-c2ccccn2)C(C#N)=C(F)/C1=C(\C#N)[N+]#[C-] |
| InChI | InChI=1S/C31H9F2N7/c1-36-19(15-35)23-24-20(16-10-6-5-7-11-16)25-26(30(37-2)29(33)27(25)31(38-3)39-4)22(18-12-8-9-13-40-18)21(24)17(14-34)28(23)32/h5-13H/b23-19+ |
| InChIKey | YZWLJTKPYFONBR-FCDQGJHFSA-N |
| XLogP | 7.87 |
| TPSA | 77.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|