C24H19F6O4S+ — CID 164746426
(3-methoxycarbonylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium (PubChem CID 164746426) has the molecular formula C24H19F6O4S+ and a molecular weight of 517.47 g/mol. Its IUPAC name is (3-methoxycarbonylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium.
| Compound Name | (3-methoxycarbonylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 164746426 |
| Molecular Formula | C24H19F6O4S+ |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | (3-methoxycarbonylphenyl)-phenyl-[4-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]sulfanium |
| SMILES | COC(=O)c1cccc([S+](c2ccccc2)c2ccc(OCC(O)(C(F)(F)F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H19F6O4S/c1-33-21(31)16-6-5-9-20(14-16)35(18-7-3-2-4-8-18)19-12-10-17(11-13-19)34-15-22(32,23(25,26)27)24(28,29)30/h2-14,32H,15H2,1H3/q+1 |
| InChIKey | GCJKZXQSECIWQM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|