C27H19F3IO3S+ — CID 164746429
[4-(4-iodophenoxy)phenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium (PubChem CID 164746429) has the molecular formula C27H19F3IO3S+ and a molecular weight of 607.41 g/mol. Its IUPAC name is [4-(4-iodophenoxy)phenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium.
| Compound Name | [4-(4-iodophenoxy)phenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 164746429 |
| Molecular Formula | C27H19F3IO3S+ |
| Molecular Weight | 607.41 g/mol |
| Exact Mass | 607.00 |
| IUPAC Name | [4-(4-iodophenoxy)phenyl]-phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]sulfanium |
| SMILES | O=C(OCC(F)(F)F)c1ccccc1[S+](c1ccccc1)c1ccc(Oc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C27H19F3IO3S/c28-27(29,30)18-33-26(32)24-8-4-5-9-25(24)35(22-6-2-1-3-7-22)23-16-14-21(15-17-23)34-20-12-10-19(31)11-13-20/h1-17H,18H2/q+1 |
| InChIKey | LYUNHIPBZNPIDM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.41 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|