C27H17F3I3O3S+ — CID 164746505
phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]-[4-(2,4,6-triiodophenoxy)phenyl]sulfanium (PubChem CID 164746505) has the molecular formula C27H17F3I3O3S+ and a molecular weight of 859.20 g/mol. Its IUPAC name is phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]-[4-(2,4,6-triiodophenoxy)phenyl]sulfanium.
| Compound Name | phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]-[4-(2,4,6-triiodophenoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 164746505 |
| Molecular Formula | C27H17F3I3O3S+ |
| Molecular Weight | 859.20 g/mol |
| Exact Mass | 858.80 |
| IUPAC Name | phenyl-[2-(2,2,2-trifluoroethoxycarbonyl)phenyl]-[4-(2,4,6-triiodophenoxy)phenyl]sulfanium |
| SMILES | O=C(OCC(F)(F)F)c1ccccc1[S+](c1ccccc1)c1ccc(Oc2c(I)cc(I)cc2I)cc1 |
| InChI | InChI=1S/C27H17F3I3O3S/c28-27(29,30)16-35-26(34)21-8-4-5-9-24(21)37(19-6-2-1-3-7-19)20-12-10-18(11-13-20)36-25-22(32)14-17(31)15-23(25)33/h1-15H,16H2/q+1 |
| InChIKey | ANDRCPWJWZIYGA-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.20 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|