C24H20F3O5S+ — CID 164747252
2,2,2-trifluoroethyl 3-[3-(2-methoxyethoxy)phenoxathiin-10-ium-10-yl]benzoate (PubChem CID 164747252) has the molecular formula C24H20F3O5S+ and a molecular weight of 477.48 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[3-(2-methoxyethoxy)phenoxathiin-10-ium-10-yl]benzoate.
| Compound Name | 2,2,2-trifluoroethyl 3-[3-(2-methoxyethoxy)phenoxathiin-10-ium-10-yl]benzoate |
|---|---|
| PubChem CID | 164747252 |
| Molecular Formula | C24H20F3O5S+ |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[3-(2-methoxyethoxy)phenoxathiin-10-ium-10-yl]benzoate |
| SMILES | COCCOc1ccc2c(c1)Oc1ccccc1[S+]2c1cccc(C(=O)OCC(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3O5S/c1-29-11-12-30-17-9-10-22-20(14-17)32-19-7-2-3-8-21(19)33(22)18-6-4-5-16(13-18)23(28)31-15-24(25,26)27/h2-10,13-14H,11-12,15H2,1H3/q+1 |
| InChIKey | LADRYLWEHJSFAZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|