C28H24N4O2 — CID 164762390
(3S)-5-hydroxy-3-[2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)-1H-indol-3-yl]-2,3-dihydroisoindol-1-one (PubChem CID 164762390) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is (3S)-5-hydroxy-3-[2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)-1H-indol-3-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | (3S)-5-hydroxy-3-[2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)-1H-indol-3-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 164762390 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3S)-5-hydroxy-3-[2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylmethyl)-1H-indol-3-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1N[C@H](c2c(CN3CCc4[nH]c5ccccc5c4C3)[nH]c3ccccc23)c2cc(O)ccc21 |
| InChI | InChI=1S/C28H24N4O2/c33-16-9-10-18-20(13-16)27(31-28(18)34)26-19-6-2-4-8-23(19)30-25(26)15-32-12-11-24-21(14-32)17-5-1-3-7-22(17)29-24/h1-10,13,27,29-30,33H,11-12,14-15H2,(H,31,34)/t27-/m0/s1 |
| InChIKey | YLQHGMHZWSLCRW-MHZLTWQESA-N |
| XLogP | 4.75 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|