C24H24N2O2 — CID 170135823
(3R)-3-[2-(cyclohept-3-en-1-ylmethyl)-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one (PubChem CID 170135823) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3R)-3-[2-(cyclohept-3-en-1-ylmethyl)-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one.
| Compound Name | (3R)-3-[2-(cyclohept-3-en-1-ylmethyl)-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 170135823 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3R)-3-[2-(cyclohept-3-en-1-ylmethyl)-1H-indol-3-yl]-5-hydroxy-2,3-dihydroisoindol-1-one |
| SMILES | O=C1N[C@@H](c2c(CC3CC=CCCC3)[nH]c3ccccc23)c2cc(O)ccc21 |
| InChI | InChI=1S/C24H24N2O2/c27-16-11-12-17-19(14-16)23(26-24(17)28)22-18-9-5-6-10-20(18)25-21(22)13-15-7-3-1-2-4-8-15/h1,3,5-6,9-12,14-15,23,25,27H,2,4,7-8,13H2,(H,26,28)/t15?,23-/m1/s1 |
| InChIKey | JKARXWQQAIAXHL-RYDFDWSBSA-N |
| XLogP | 5.00 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|