C45H25N7 — CID 164766403
6-(3,5-diisocyanophenyl)-12-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]quinolino[6,5-f]quinoline (PubChem CID 164766403) has the molecular formula C45H25N7 and a molecular weight of 663.74 g/mol. Its IUPAC name is 6-(3,5-diisocyanophenyl)-12-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]quinolino[6,5-f]quinoline.
| Compound Name | 6-(3,5-diisocyanophenyl)-12-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]quinolino[6,5-f]quinoline |
|---|---|
| PubChem CID | 164766403 |
| Molecular Formula | C45H25N7 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 6-(3,5-diisocyanophenyl)-12-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]quinolino[6,5-f]quinoline |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(-c2cc3c4cccnc4c(-c4cccc(-c5cc(-c6ccncc6)nc(-c6ccncc6)c5)c4)cc3c3cccnc23)c1 |
| InChI | InChI=1S/C45H25N7/c1-46-34-21-33(22-35(25-34)47-2)39-27-41-36-8-4-14-50-44(36)38(26-40(41)37-9-5-15-51-45(37)39)31-7-3-6-30(20-31)32-23-42(28-10-16-48-17-11-28)52-43(24-32)29-12-18-49-19-13-29/h3-27H |
| InChIKey | SORIMMPPFQPCBH-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 73.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|