C15H20Br2N4O3 — CID 164780145
tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(methoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 164780145) has the molecular formula C15H20Br2N4O3 and a molecular weight of 464.16 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(methoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164780145 |
| Molecular Formula | C15H20Br2N4O3 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | tert-butyl (2R,4S)-4-(3,5-dibromo-4-isocyanopyrazol-1-yl)-2-(methoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(Br)nn([C@H]2C[C@H](COC)N(C(=O)OC(C)(C)C)C2)c1Br |
| InChI | InChI=1S/C15H20Br2N4O3/c1-15(2,3)24-14(22)20-7-9(6-10(20)8-23-5)21-13(17)11(18-4)12(16)19-21/h9-10H,6-8H2,1-3,5H3/t9-,10+/m0/s1 |
| InChIKey | LKXBJEYCTBXQGB-VHSXEESVSA-N |
| XLogP | 4.16 |
| TPSA | 60.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|