C29H29FN2O — CID 164781397
9-[(2,5-dimethylphenyl)methyl]-N-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 164781397) has the molecular formula C29H29FN2O and a molecular weight of 440.56 g/mol. Its IUPAC name is 9-[(2,5-dimethylphenyl)methyl]-N-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-[(2,5-dimethylphenyl)methyl]-N-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 164781397 |
| Molecular Formula | C29H29FN2O |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 9-[(2,5-dimethylphenyl)methyl]-N-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2c3c(c4ccccc42)CC(C(=O)NCc2ccccc2F)CC3)c1 |
| InChI | InChI=1S/C29H29FN2O/c1-19-11-12-20(2)23(15-19)18-32-27-10-6-4-8-24(27)25-16-21(13-14-28(25)32)29(33)31-17-22-7-3-5-9-26(22)30/h3-12,15,21H,13-14,16-18H2,1-2H3,(H,31,33) |
| InChIKey | MAXDUWNNCCNRHW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|