C28H29N3O — CID 154688122
9-[(2,5-dimethylphenyl)methyl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 154688122) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is 9-[(2,5-dimethylphenyl)methyl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | 9-[(2,5-dimethylphenyl)methyl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 154688122 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 9-[(2,5-dimethylphenyl)methyl]-N-(pyridin-4-ylmethyl)-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2c3c(c4ccccc42)CC(C(=O)NCc2ccncc2)CC3)c1 |
| InChI | InChI=1S/C28H29N3O/c1-19-7-8-20(2)23(15-19)18-31-26-6-4-3-5-24(26)25-16-22(9-10-27(25)31)28(32)30-17-21-11-13-29-14-12-21/h3-8,11-15,22H,9-10,16-18H2,1-2H3,(H,30,32) |
| InChIKey | AUSOOCRZFSFRHP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|