C28H27FN2O — CID 154688230
(3S)-N-(2,3-dimethylphenyl)-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide (PubChem CID 154688230) has the molecular formula C28H27FN2O and a molecular weight of 426.54 g/mol. Its IUPAC name is (3S)-N-(2,3-dimethylphenyl)-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide.
| Compound Name | (3S)-N-(2,3-dimethylphenyl)-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 154688230 |
| Molecular Formula | C28H27FN2O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3S)-N-(2,3-dimethylphenyl)-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2CCc3c(c4ccccc4n3Cc3cccc(F)c3)C2)c1C |
| InChI | InChI=1S/C28H27FN2O/c1-18-7-5-11-25(19(18)2)30-28(32)21-13-14-27-24(16-21)23-10-3-4-12-26(23)31(27)17-20-8-6-9-22(29)15-20/h3-12,15,21H,13-14,16-17H2,1-2H3,(H,30,32)/t21-/m0/s1 |
| InChIKey | QNMXRFPVVPNHCN-NRFANRHFSA-N |
| XLogP | 6.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|