C23H22BrFN2O — CID 59161198
N-[6-bromo-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide (PubChem CID 59161198) has the molecular formula C23H22BrFN2O and a molecular weight of 441.34 g/mol. Its IUPAC name is N-[6-bromo-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[6-bromo-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 59161198 |
| Molecular Formula | C23H22BrFN2O |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-[6-bromo-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide |
| SMILES | O=C(NC1CCc2c(c3cc(Br)ccc3n2Cc2cccc(F)c2)C1)C1CC1 |
| InChI | InChI=1S/C23H22BrFN2O/c24-16-6-8-21-19(11-16)20-12-18(26-23(28)15-4-5-15)7-9-22(20)27(21)13-14-2-1-3-17(25)10-14/h1-3,6,8,10-11,15,18H,4-5,7,9,12-13H2,(H,26,28) |
| InChIKey | FJFGVVMCLPKLFO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|