C24H24FN3O2 — CID 91526066
N-[(3R)-9-[(3-fluorophenyl)methyl]-6-(nitrosomethyl)-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide (PubChem CID 91526066) has the molecular formula C24H24FN3O2 and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[(3R)-9-[(3-fluorophenyl)methyl]-6-(nitrosomethyl)-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[(3R)-9-[(3-fluorophenyl)methyl]-6-(nitrosomethyl)-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 91526066 |
| Molecular Formula | C24H24FN3O2 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[(3R)-9-[(3-fluorophenyl)methyl]-6-(nitrosomethyl)-1,2,3,4-tetrahydrocarbazol-3-yl]cyclopropanecarboxamide |
| SMILES | O=NCc1ccc2c(c1)c1c(n2Cc2cccc(F)c2)CC[C@@H](NC(=O)C2CC2)C1 |
| InChI | InChI=1S/C24H24FN3O2/c25-18-3-1-2-16(10-18)14-28-22-8-4-15(13-26-30)11-20(22)21-12-19(7-9-23(21)28)27-24(29)17-5-6-17/h1-4,8,10-11,17,19H,5-7,9,12-14H2,(H,27,29)/t19-/m1/s1 |
| InChIKey | JOTRBIYOFGSZMZ-LJQANCHMSA-N |
| XLogP | 4.48 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|