C27H21FN4O4 — CID 57431674
(4-nitrophenyl) N-[6-cyano-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamate (PubChem CID 57431674) has the molecular formula C27H21FN4O4 and a molecular weight of 484.49 g/mol. Its IUPAC name is (4-nitrophenyl) N-[6-cyano-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamate.
| Compound Name | (4-nitrophenyl) N-[6-cyano-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamate |
|---|---|
| PubChem CID | 57431674 |
| Molecular Formula | C27H21FN4O4 |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (4-nitrophenyl) N-[6-cyano-9-[(3-fluorophenyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamate |
| SMILES | N#Cc1ccc2c(c1)c1c(n2Cc2cccc(F)c2)CCC(NC(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C27H21FN4O4/c28-19-3-1-2-18(12-19)16-31-25-10-4-17(15-29)13-23(25)24-14-20(5-11-26(24)31)30-27(33)36-22-8-6-21(7-9-22)32(34)35/h1-4,6-10,12-13,20H,5,11,14,16H2,(H,30,33) |
| InChIKey | AIPBZLAIJDHDCB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|