C20H17FN4O2 — CID 68533390
[6-cyano-9-[(6-fluoro-2-pyridinyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamic acid (PubChem CID 68533390) has the molecular formula C20H17FN4O2 and a molecular weight of 364.38 g/mol. Its IUPAC name is [6-cyano-9-[(6-fluoro-2-pyridinyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamic acid.
| Compound Name | [6-cyano-9-[(6-fluoro-2-pyridinyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68533390 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [6-cyano-9-[(6-fluoro-2-pyridinyl)methyl]-1,2,3,4-tetrahydrocarbazol-3-yl]carbamic acid |
| SMILES | N#Cc1ccc2c(c1)c1c(n2Cc2cccc(F)n2)CCC(NC(=O)O)C1 |
| InChI | InChI=1S/C20H17FN4O2/c21-19-3-1-2-14(23-19)11-25-17-6-4-12(10-22)8-15(17)16-9-13(24-20(26)27)5-7-18(16)25/h1-4,6,8,13,24H,5,7,9,11H2,(H,26,27) |
| InChIKey | IVSVQSUIRVYRBM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|