C16H14N4S — CID 59242717
(2R)-2-amino-4-(1,2-thiazol-3-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile (PubChem CID 59242717) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is (2R)-2-amino-4-(1,2-thiazol-3-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile.
| Compound Name | (2R)-2-amino-4-(1,2-thiazol-3-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile |
|---|---|
| PubChem CID | 59242717 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (2R)-2-amino-4-(1,2-thiazol-3-ylmethyl)-2,3-dihydro-1H-cyclopenta[b]indole-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1c(n2Cc2ccsn2)C[C@H](N)C1 |
| InChI | InChI=1S/C16H14N4S/c17-8-10-1-2-15-13(5-10)14-6-11(18)7-16(14)20(15)9-12-3-4-21-19-12/h1-5,11H,6-7,9,18H2/t11-/m1/s1 |
| InChIKey | GDZIWQLOALRQAA-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|