C24H23FN2O3 — CID 58149401
propan-2-yl 2-[(2S)-7-cyano-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]acetate (PubChem CID 58149401) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is propan-2-yl 2-[(2S)-7-cyano-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]acetate.
| Compound Name | propan-2-yl 2-[(2S)-7-cyano-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]acetate |
|---|---|
| PubChem CID | 58149401 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | propan-2-yl 2-[(2S)-7-cyano-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]acetate |
| SMILES | CC(C)OC(=O)C[C@H]1Cc2c(n(Cc3cc(F)ccc3O)c3ccc(C#N)cc23)C1 |
| InChI | InChI=1S/C24H23FN2O3/c1-14(2)30-24(29)10-16-8-20-19-7-15(12-26)3-5-21(19)27(22(20)9-16)13-17-11-18(25)4-6-23(17)28/h3-7,11,14,16,28H,8-10,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | AODQZKPQBJGTMT-INIZCTEOSA-N |
| XLogP | 4.46 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|