C22H24FN3O3 — CID 89117726
propan-2-yl N-[(2S)-7-amino-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate (PubChem CID 89117726) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-7-amino-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-7-amino-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate |
|---|---|
| PubChem CID | 89117726 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | propan-2-yl N-[(2S)-7-amino-4-[(5-fluoro-2-hydroxyphenyl)methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@H]1Cc2c(n(Cc3cc(F)ccc3O)c3ccc(N)cc23)C1 |
| InChI | InChI=1S/C22H24FN3O3/c1-12(2)29-22(28)25-16-9-18-17-8-15(24)4-5-19(17)26(20(18)10-16)11-13-7-14(23)3-6-21(13)27/h3-8,12,16,27H,9-11,24H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | RTAFUKYQXPBTQC-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|