C22H32N4O3 — CID 89117709
propan-2-yl N-[(2S)-7-amino-4-[[(2S,3R)-3-hydroxy-1,3-dimethylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate (PubChem CID 89117709) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-7-amino-4-[[(2S,3R)-3-hydroxy-1,3-dimethylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-7-amino-4-[[(2S,3R)-3-hydroxy-1,3-dimethylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate |
|---|---|
| PubChem CID | 89117709 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | propan-2-yl N-[(2S)-7-amino-4-[[(2S,3R)-3-hydroxy-1,3-dimethylpyrrolidin-2-yl]methyl]-2,3-dihydro-1H-cyclopenta[b]indol-2-yl]carbamate |
| SMILES | CC(C)OC(=O)N[C@H]1Cc2c(n(C[C@@H]3N(C)CC[C@@]3(C)O)c3ccc(N)cc23)C1 |
| InChI | InChI=1S/C22H32N4O3/c1-13(2)29-21(27)24-15-10-17-16-9-14(23)5-6-18(16)26(19(17)11-15)12-20-22(3,28)7-8-25(20)4/h5-6,9,13,15,20,28H,7-8,10-12,23H2,1-4H3,(H,24,27)/t15-,20-,22+/m0/s1 |
| InChIKey | PTSICWVZEZRWMR-GJULWVSJSA-N |
| XLogP | 2.28 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|