C23H25FN2O3 — CID 71220184
N-[9-[(3-fluorophenyl)methyl]-6,7-dihydroxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide (PubChem CID 71220184) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is N-[9-[(3-fluorophenyl)methyl]-6,7-dihydroxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(3-fluorophenyl)methyl]-6,7-dihydroxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71220184 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[9-[(3-fluorophenyl)methyl]-6,7-dihydroxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CCc2c(c3cc(O)c(O)cc3n2Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C23H25FN2O3/c1-13(2)23(29)25-16-6-7-19-17(9-16)18-10-21(27)22(28)11-20(18)26(19)12-14-4-3-5-15(24)8-14/h3-5,8,10-11,13,16,27-28H,6-7,9,12H2,1-2H3,(H,25,29) |
| InChIKey | WFCKYDLDKYSJHS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|