C26H31FN2O2 — CID 59161273
N-[9-[(3-fluorophenyl)methyl]-6-propoxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide (PubChem CID 59161273) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is N-[9-[(3-fluorophenyl)methyl]-6-propoxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(3-fluorophenyl)methyl]-6-propoxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 59161273 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N-[9-[(3-fluorophenyl)methyl]-6-propoxy-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
| SMILES | CCCOc1ccc2c(c1)c1c(n2Cc2cccc(F)c2)CCC(NC(=O)C(C)C)C1 |
| InChI | InChI=1S/C26H31FN2O2/c1-4-12-31-21-9-11-25-23(15-21)22-14-20(28-26(30)17(2)3)8-10-24(22)29(25)16-18-6-5-7-19(27)13-18/h5-7,9,11,13,15,17,20H,4,8,10,12,14,16H2,1-3H3,(H,28,30) |
| InChIKey | IGEJIGLQFKIGQA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|