C22H22ClN3OS — CID 59161214
N-[9-[(5-chlorothiophen-2-yl)methyl]-6-cyano-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide (PubChem CID 59161214) has the molecular formula C22H22ClN3OS and a molecular weight of 411.96 g/mol. Its IUPAC name is N-[9-[(5-chlorothiophen-2-yl)methyl]-6-cyano-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(5-chlorothiophen-2-yl)methyl]-6-cyano-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 59161214 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[9-[(5-chlorothiophen-2-yl)methyl]-6-cyano-1,2,3,4-tetrahydrocarbazol-3-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC1CCc2c(c3cc(C#N)ccc3n2Cc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C22H22ClN3OS/c1-13(2)22(27)25-15-4-7-20-18(10-15)17-9-14(11-24)3-6-19(17)26(20)12-16-5-8-21(23)28-16/h3,5-6,8-9,13,15H,4,7,10,12H2,1-2H3,(H,25,27) |
| InChIKey | BLQSWNWTJUGIAA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|